C44H76N2 — CID 58798916
N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]octane-1,8-diamine (PubChem CID 58798916) has the molecular formula C44H76N2 and a molecular weight of 633.11 g/mol. Its IUPAC name is N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]octane-1,8-diamine.
| Compound Name | N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]octane-1,8-diamine |
|---|---|
| PubChem CID | 58798916 |
| Molecular Formula | C44H76N2 |
| Molecular Weight | 633.11 g/mol |
| Exact Mass | 632.60 |
| IUPAC Name | N,N,N',N'-tetrakis[(1S,4R,5R,6S)-4,5,6-trimethylcyclohex-2-en-1-yl]octane-1,8-diamine |
| SMILES | C[C@H]1[C@H](C)[C@@H](N(CCCCCCCCN([C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)[C@H]2C=C[C@@H](C)[C@@H](C)[C@@H]2C)C=C[C@H]1C |
| InChI | InChI=1S/C44H76N2/c1-29-19-23-41(37(9)33(29)5)45(42-24-20-30(2)34(6)38(42)10)27-17-15-13-14-16-18-28-46(43-25-21-31(3)35(7)39(43)11)44-26-22-32(4)36(8)40(44)12/h19-26,29-44H,13-18,27-28H2,1-12H3/t29-,30-,31-,32-,33-,34-,35-,36-,37+,38+,39+,40+,41+,42+,43+,44+/m1/s1 |
| InChIKey | WHBDGLIPRLGULJ-VFUOEQRXSA-N |
| XLogP | 11.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.11 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|