About 4,5-difluoro-1-methyl-3,6-dihydro-2H-pyridine
4,5-difluoro-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 58799113) has the molecular formula C6H9F2N
and a molecular weight of 133.14 g/mol. Its IUPAC name is 4,5-difluoro-1-methyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 4,5-difluoro-1-methyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 58799113 |
| Molecular Formula | C6H9F2N |
| Molecular Weight | 133.14 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 4,5-difluoro-1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CN1CCC(F)=C(F)C1 |
| InChI | InChI=1S/C6H9F2N/c1-9-3-2-5(7)6(8)4-9/h2-4H2,1H3 |
| InChIKey | OHCXIAXIXBNGJA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.14 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,5-difluoro-1-methyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-difluoro-1-methyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 4,5-difluoro-1-methyl-3,6-dihydro-2H-pyridine (CID 58799113) is 4,5-difluoro-1-methyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 4,5-difluoro-1-methyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 4,5-difluoro-1-methyl-3,6-dihydro-2H-pyridine is CN1CCC(F)=C(F)C1.
What is the InChIKey of 4,5-difluoro-1-methyl-3,6-dihydro-2H-pyridine?
The InChIKey is OHCXIAXIXBNGJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F2N/c1-9-3-2-5(7)6(8)4-9/h2-4H2,1H3.
What are the key properties of 4,5-difluoro-1-methyl-3,6-dihydro-2H-pyridine?
4,5-difluoro-1-methyl-3,6-dihydro-2H-pyridine has a molecular weight of 133.14 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-difluoro-1-methyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 58799113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).