C32H31ClN4O3 — CID 58799316
N-butyl-4-[[4-(3-chlorophenyl)-1-methyl-2-oxoquinolin-6-yl]-hydroxy-(3-methylimidazol-4-yl)methyl]benzamide (PubChem CID 58799316) has the molecular formula C32H31ClN4O3 and a molecular weight of 555.08 g/mol. Its IUPAC name is N-butyl-4-[[4-(3-chlorophenyl)-1-methyl-2-oxoquinolin-6-yl]-hydroxy-(3-methylimidazol-4-yl)methyl]benzamide.
| Compound Name | N-butyl-4-[[4-(3-chlorophenyl)-1-methyl-2-oxoquinolin-6-yl]-hydroxy-(3-methylimidazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 58799316 |
| Molecular Formula | C32H31ClN4O3 |
| Molecular Weight | 555.08 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | N-butyl-4-[[4-(3-chlorophenyl)-1-methyl-2-oxoquinolin-6-yl]-hydroxy-(3-methylimidazol-4-yl)methyl]benzamide |
| SMILES | CCCCNC(=O)c1ccc(C(O)(c2ccc3c(c2)c(-c2cccc(Cl)c2)cc(=O)n3C)c2cncn2C)cc1 |
| InChI | InChI=1S/C32H31ClN4O3/c1-4-5-15-35-31(39)21-9-11-23(12-10-21)32(40,29-19-34-20-36(29)2)24-13-14-28-27(17-24)26(18-30(38)37(28)3)22-7-6-8-25(33)16-22/h6-14,16-20,40H,4-5,15H2,1-3H3,(H,35,39) |
| InChIKey | ZRVKVZCDDZOFDX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.08 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|