About (2S)-1-(1,1-dioxothiazinan-2-yl)-3,3-dimethylbutan-2-amine
(2S)-1-(1,1-dioxothiazinan-2-yl)-3,3-dimethylbutan-2-amine (PubChem CID 58799657) has the molecular formula C10H22N2O2S
and a molecular weight of 234.36 g/mol. Its IUPAC name is (2S)-1-(1,1-dioxothiazinan-2-yl)-3,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | (2S)-1-(1,1-dioxothiazinan-2-yl)-3,3-dimethylbutan-2-amine |
| PubChem CID | 58799657 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (2S)-1-(1,1-dioxothiazinan-2-yl)-3,3-dimethylbutan-2-amine |
| SMILES | CC(C)(C)[C@H](N)CN1CCCCS1(=O)=O |
| InChI | InChI=1S/C10H22N2O2S/c1-10(2,3)9(11)8-12-6-4-5-7-15(12,13)14/h9H,4-8,11H2,1-3H3/t9-/m1/s1 |
| InChIKey | ZQSBNTWUSFWPHF-SECBINFHSA-N |
| XLogP | 0.79 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-1-(1,1-dioxothiazinan-2-yl)-3,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-(1,1-dioxothiazinan-2-yl)-3,3-dimethylbutan-2-amine?
The IUPAC name of (2S)-1-(1,1-dioxothiazinan-2-yl)-3,3-dimethylbutan-2-amine (CID 58799657) is (2S)-1-(1,1-dioxothiazinan-2-yl)-3,3-dimethylbutan-2-amine.
What is the SMILES notation for (2S)-1-(1,1-dioxothiazinan-2-yl)-3,3-dimethylbutan-2-amine?
The canonical SMILES for (2S)-1-(1,1-dioxothiazinan-2-yl)-3,3-dimethylbutan-2-amine is CC(C)(C)[C@H](N)CN1CCCCS1(=O)=O.
What is the InChIKey of (2S)-1-(1,1-dioxothiazinan-2-yl)-3,3-dimethylbutan-2-amine?
The InChIKey is ZQSBNTWUSFWPHF-SECBINFHSA-N. The full InChI is InChI=1S/C10H22N2O2S/c1-10(2,3)9(11)8-12-6-4-5-7-15(12,13)14/h9H,4-8,11H2,1-3H3/t9-/m1/s1.
What are the key properties of (2S)-1-(1,1-dioxothiazinan-2-yl)-3,3-dimethylbutan-2-amine?
(2S)-1-(1,1-dioxothiazinan-2-yl)-3,3-dimethylbutan-2-amine has a molecular weight of 234.36 g/mol, XLogP of 0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(1,1-dioxothiazinan-2-yl)-3,3-dimethylbutan-2-amine is sourced from PubChem (CID 58799657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).