About 3,3-dimethyl-1-(2-methylpropyl)pyrrolidine-2,5-dione
3,3-dimethyl-1-(2-methylpropyl)pyrrolidine-2,5-dione (PubChem CID 58799802) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2-methylpropyl)pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 3,3-dimethyl-1-(2-methylpropyl)pyrrolidine-2,5-dione |
| PubChem CID | 58799802 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 3,3-dimethyl-1-(2-methylpropyl)pyrrolidine-2,5-dione |
| SMILES | CC(C)CN1C(=O)CC(C)(C)C1=O |
| InChI | InChI=1S/C10H17NO2/c1-7(2)6-11-8(12)5-10(3,4)9(11)13/h7H,5-6H2,1-4H3 |
| InChIKey | ZMGPAUULEPRPOK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-1-(2-methylpropyl)pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1-(2-methylpropyl)pyrrolidine-2,5-dione?
The IUPAC name of 3,3-dimethyl-1-(2-methylpropyl)pyrrolidine-2,5-dione (CID 58799802) is 3,3-dimethyl-1-(2-methylpropyl)pyrrolidine-2,5-dione.
What is the SMILES notation for 3,3-dimethyl-1-(2-methylpropyl)pyrrolidine-2,5-dione?
The canonical SMILES for 3,3-dimethyl-1-(2-methylpropyl)pyrrolidine-2,5-dione is CC(C)CN1C(=O)CC(C)(C)C1=O.
What is the InChIKey of 3,3-dimethyl-1-(2-methylpropyl)pyrrolidine-2,5-dione?
The InChIKey is ZMGPAUULEPRPOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-7(2)6-11-8(12)5-10(3,4)9(11)13/h7H,5-6H2,1-4H3.
What are the key properties of 3,3-dimethyl-1-(2-methylpropyl)pyrrolidine-2,5-dione?
3,3-dimethyl-1-(2-methylpropyl)pyrrolidine-2,5-dione has a molecular weight of 183.25 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-(2-methylpropyl)pyrrolidine-2,5-dione is sourced from PubChem (CID 58799802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).