C9H19O7P2W- — CID 58800954
[(1R,3R)-2-[hydroxy(methyl)phosphoryl]oxy-3-methoxycyclopentyl]methoxy-methylphosphinic acid;tungsten (PubChem CID 58800954) has the molecular formula C9H19O7P2W- and a molecular weight of 485.03 g/mol. Its IUPAC name is [(1R,3R)-2-[hydroxy(methyl)phosphoryl]oxy-3-methoxycyclopentyl]methoxy-methylphosphinic acid;tungsten.
| Compound Name | [(1R,3R)-2-[hydroxy(methyl)phosphoryl]oxy-3-methoxycyclopentyl]methoxy-methylphosphinic acid;tungsten |
|---|---|
| PubChem CID | 58800954 |
| Molecular Formula | C9H19O7P2W- |
| Molecular Weight | 485.03 g/mol |
| Exact Mass | 485.01 |
| IUPAC Name | [(1R,3R)-2-[hydroxy(methyl)phosphoryl]oxy-3-methoxycyclopentyl]methoxy-methylphosphinic acid;tungsten |
| SMILES | CO[C@@H]1[CH-]C[C@H](COP(C)(=O)O)C1OP(C)(=O)O.[W] |
| InChI | InChI=1S/C9H19O7P2.W/c1-14-8-5-4-7(6-15-17(2,10)11)9(8)16-18(3,12)13;/h5,7-9H,4,6H2,1-3H3,(H,10,11)(H,12,13);/q-1;/t7-,8-,9?;/m1./s1 |
| InChIKey | LGKLHNGBNXQFCR-HMEHNGNUSA-N |
| XLogP | 1.26 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.03 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|