C20H22N2O3 — CID 58801135
(4-carbamoyl-3-phenylphenyl) N-cyclohexylcarbamate (PubChem CID 58801135) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is (4-carbamoyl-3-phenylphenyl) N-cyclohexylcarbamate.
| Compound Name | (4-carbamoyl-3-phenylphenyl) N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 58801135 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (4-carbamoyl-3-phenylphenyl) N-cyclohexylcarbamate |
| SMILES | NC(=O)c1ccc(OC(=O)NC2CCCCC2)cc1-c1ccccc1 |
| InChI | InChI=1S/C20H22N2O3/c21-19(23)17-12-11-16(13-18(17)14-7-3-1-4-8-14)25-20(24)22-15-9-5-2-6-10-15/h1,3-4,7-8,11-13,15H,2,5-6,9-10H2,(H2,21,23)(H,22,24) |
| InChIKey | NNRPFNHFWJYWGE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |