C14H12N6S — CID 58801371
N,12-dimethyl-4-pyridin-2-yl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine (PubChem CID 58801371) has the molecular formula C14H12N6S and a molecular weight of 296.36 g/mol. Its IUPAC name is N,12-dimethyl-4-pyridin-2-yl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine.
| Compound Name | N,12-dimethyl-4-pyridin-2-yl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
|---|---|
| PubChem CID | 58801371 |
| Molecular Formula | C14H12N6S |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N,12-dimethyl-4-pyridin-2-yl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
| SMILES | CNc1nc2sc(-c3ccccn3)nc2c2c1ncn2C |
| InChI | InChI=1S/C14H12N6S/c1-15-12-9-11(20(2)7-17-9)10-14(19-12)21-13(18-10)8-5-3-4-6-16-8/h3-7H,1-2H3,(H,15,19) |
| InChIKey | NZOWPUZYSZLVQB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |