C14H14N6OS — CID 58801476
4-N-(furan-2-ylmethyl)-8-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaene-4,8-diamine (PubChem CID 58801476) has the molecular formula C14H14N6OS and a molecular weight of 314.37 g/mol. Its IUPAC name is 4-N-(furan-2-ylmethyl)-8-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaene-4,8-diamine.
| Compound Name | 4-N-(furan-2-ylmethyl)-8-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaene-4,8-diamine |
|---|---|
| PubChem CID | 58801476 |
| Molecular Formula | C14H14N6OS |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 4-N-(furan-2-ylmethyl)-8-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaene-4,8-diamine |
| SMILES | CNc1nc2sc(NCc3ccco3)nc2c2c1ncn2C |
| InChI | InChI=1S/C14H14N6OS/c1-15-12-9-11(20(2)7-17-9)10-13(19-12)22-14(18-10)16-6-8-4-3-5-21-8/h3-5,7H,6H2,1-2H3,(H,15,19)(H,16,18) |
| InChIKey | ADCLHACPDVSKQE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 80.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |