C18H19N7OS — CID 58801542
N,12-dimethyl-4-(6-morpholin-4-yl-3-pyridinyl)-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine (PubChem CID 58801542) has the molecular formula C18H19N7OS and a molecular weight of 381.47 g/mol. Its IUPAC name is N,12-dimethyl-4-(6-morpholin-4-yl-3-pyridinyl)-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine.
| Compound Name | N,12-dimethyl-4-(6-morpholin-4-yl-3-pyridinyl)-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
|---|---|
| PubChem CID | 58801542 |
| Molecular Formula | C18H19N7OS |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N,12-dimethyl-4-(6-morpholin-4-yl-3-pyridinyl)-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
| SMILES | CNc1nc2sc(-c3ccc(N4CCOCC4)nc3)nc2c2c1ncn2C |
| InChI | InChI=1S/C18H19N7OS/c1-19-16-13-15(24(2)10-21-13)14-18(23-16)27-17(22-14)11-3-4-12(20-9-11)25-5-7-26-8-6-25/h3-4,9-10H,5-8H2,1-2H3,(H,19,23) |
| InChIKey | OZNNFDGJCVEVOT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |