C17H14N6S — CID 58801606
4-(1H-indol-5-yl)-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine (PubChem CID 58801606) has the molecular formula C17H14N6S and a molecular weight of 334.41 g/mol. Its IUPAC name is 4-(1H-indol-5-yl)-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine.
| Compound Name | 4-(1H-indol-5-yl)-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
|---|---|
| PubChem CID | 58801606 |
| Molecular Formula | C17H14N6S |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 4-(1H-indol-5-yl)-N,12-dimethyl-5-thia-3,7,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-8-amine |
| SMILES | CNc1nc2sc(-c3ccc4[nH]ccc4c3)nc2c2c1ncn2C |
| InChI | InChI=1S/C17H14N6S/c1-18-15-12-14(23(2)8-20-12)13-17(22-15)24-16(21-13)10-3-4-11-9(7-10)5-6-19-11/h3-8,19H,1-2H3,(H,18,22) |
| InChIKey | ZSOGQXCGAJZIGV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |