C23H30N2O — CID 58802157
(4aR,8aS,10aR)-3-isocyano-1,1,4a,8a-tetramethyl-6-pyrrolidin-1-yl-8,9,10,10a-tetrahydrophenanthren-2-one (PubChem CID 58802157) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is (4aR,8aS,10aR)-3-isocyano-1,1,4a,8a-tetramethyl-6-pyrrolidin-1-yl-8,9,10,10a-tetrahydrophenanthren-2-one.
| Compound Name | (4aR,8aS,10aR)-3-isocyano-1,1,4a,8a-tetramethyl-6-pyrrolidin-1-yl-8,9,10,10a-tetrahydrophenanthren-2-one |
|---|---|
| PubChem CID | 58802157 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | (4aR,8aS,10aR)-3-isocyano-1,1,4a,8a-tetramethyl-6-pyrrolidin-1-yl-8,9,10,10a-tetrahydrophenanthren-2-one |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(N4CCCC4)=CC[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C23H30N2O/c1-21(2)18-9-11-22(3)10-8-16(25-12-6-7-13-25)14-19(22)23(18,4)15-17(24-5)20(21)26/h8,14-15,18H,6-7,9-13H2,1-4H3/t18-,22+,23-/m0/s1 |
| InChIKey | KAZXOYAVFINGPR-NMNUPHIUSA-N |
| XLogP | 5.13 |
| TPSA | 24.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|