C23H37NO3 — CID 58802173
tert-butyl N-[[(4aS,8aS,10aR)-1,1,4a-trimethyl-2-oxo-3,4,6,7,8,9,10,10a-octahydrophenanthren-8a-yl]methyl]carbamate (PubChem CID 58802173) has the molecular formula C23H37NO3 and a molecular weight of 375.55 g/mol. Its IUPAC name is tert-butyl N-[[(4aS,8aS,10aR)-1,1,4a-trimethyl-2-oxo-3,4,6,7,8,9,10,10a-octahydrophenanthren-8a-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(4aS,8aS,10aR)-1,1,4a-trimethyl-2-oxo-3,4,6,7,8,9,10,10a-octahydrophenanthren-8a-yl]methyl]carbamate |
|---|---|
| PubChem CID | 58802173 |
| Molecular Formula | C23H37NO3 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.28 |
| IUPAC Name | tert-butyl N-[[(4aS,8aS,10aR)-1,1,4a-trimethyl-2-oxo-3,4,6,7,8,9,10,10a-octahydrophenanthren-8a-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@]12CCCC=C1[C@@]1(C)CCC(=O)C(C)(C)[C@@H]1CC2 |
| InChI | InChI=1S/C23H37NO3/c1-20(2,3)27-19(26)24-15-23-12-8-7-9-17(23)22(6)13-11-18(25)21(4,5)16(22)10-14-23/h9,16H,7-8,10-15H2,1-6H3,(H,24,26)/t16-,22-,23+/m0/s1 |
| InChIKey | WLUGRPBRCHBHIH-IRBZQWRBSA-N |
| XLogP | 5.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|