C20H31FO2 — CID 58802191
(4bS,8aR,10aS)-10a-(fluoromethyl)-4b,8,8-trimethylspiro[1,2,3,5,6,8a,9,10-octahydrophenanthrene-7,2'-1,3-dioxolane] (PubChem CID 58802191) has the molecular formula C20H31FO2 and a molecular weight of 322.46 g/mol. Its IUPAC name is (4bS,8aR,10aS)-10a-(fluoromethyl)-4b,8,8-trimethylspiro[1,2,3,5,6,8a,9,10-octahydrophenanthrene-7,2'-1,3-dioxolane].
| Compound Name | (4bS,8aR,10aS)-10a-(fluoromethyl)-4b,8,8-trimethylspiro[1,2,3,5,6,8a,9,10-octahydrophenanthrene-7,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 58802191 |
| Molecular Formula | C20H31FO2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (4bS,8aR,10aS)-10a-(fluoromethyl)-4b,8,8-trimethylspiro[1,2,3,5,6,8a,9,10-octahydrophenanthrene-7,2'-1,3-dioxolane] |
| SMILES | CC1(C)[C@@H]2CC[C@@]3(CF)CCCC=C3[C@@]2(C)CCC12OCCO2 |
| InChI | InChI=1S/C20H31FO2/c1-17(2)15-7-9-19(14-21)8-5-4-6-16(19)18(15,3)10-11-20(17)22-12-13-23-20/h6,15H,4-5,7-14H2,1-3H3/t15-,18-,19+/m0/s1 |
| InChIKey | WYIHGNWZGYBLJQ-ZYSHUDEJSA-N |
| XLogP | 5.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|