C19H24FNO2 — CID 58802201
(4R,6aR,11aS)-4-(fluoromethyl)-7,7,11a-trimethyl-4,4a,5,6,6a,11-hexahydro-3H-naphtho[1,2-f][1,2]benzoxazol-2-one (PubChem CID 58802201) has the molecular formula C19H24FNO2 and a molecular weight of 317.40 g/mol. Its IUPAC name is (4R,6aR,11aS)-4-(fluoromethyl)-7,7,11a-trimethyl-4,4a,5,6,6a,11-hexahydro-3H-naphtho[1,2-f][1,2]benzoxazol-2-one.
| Compound Name | (4R,6aR,11aS)-4-(fluoromethyl)-7,7,11a-trimethyl-4,4a,5,6,6a,11-hexahydro-3H-naphtho[1,2-f][1,2]benzoxazol-2-one |
|---|---|
| PubChem CID | 58802201 |
| Molecular Formula | C19H24FNO2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (4R,6aR,11aS)-4-(fluoromethyl)-7,7,11a-trimethyl-4,4a,5,6,6a,11-hexahydro-3H-naphtho[1,2-f][1,2]benzoxazol-2-one |
| SMILES | CC1(C)c2oncc2C[C@]2(C)C3=CC(=O)C[C@@H](CF)C3CC[C@@H]12 |
| InChI | InChI=1S/C19H24FNO2/c1-18(2)16-5-4-14-11(9-20)6-13(22)7-15(14)19(16,3)8-12-10-21-23-17(12)18/h7,10-11,14,16H,4-6,8-9H2,1-3H3/t11-,14?,16-,19+/m0/s1 |
| InChIKey | VNCVRBKBAXPHJL-MHBVWFGZSA-N |
| XLogP | 4.03 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |