C20H30O3 — CID 58802221
(1R,4bR,10aR)-4b,8,8,10a-tetramethylspiro[1,2,3,5,6,10-hexahydrophenanthrene-7,2'-1,3-dioxolane]-1-ol (PubChem CID 58802221) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1R,4bR,10aR)-4b,8,8,10a-tetramethylspiro[1,2,3,5,6,10-hexahydrophenanthrene-7,2'-1,3-dioxolane]-1-ol.
| Compound Name | (1R,4bR,10aR)-4b,8,8,10a-tetramethylspiro[1,2,3,5,6,10-hexahydrophenanthrene-7,2'-1,3-dioxolane]-1-ol |
|---|---|
| PubChem CID | 58802221 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1R,4bR,10aR)-4b,8,8,10a-tetramethylspiro[1,2,3,5,6,10-hexahydrophenanthrene-7,2'-1,3-dioxolane]-1-ol |
| SMILES | CC1(C)C2=CC[C@]3(C)C(=CCC[C@H]3O)[C@@]2(C)CCC12OCCO2 |
| InChI | InChI=1S/C20H30O3/c1-17(2)14-8-9-19(4)15(6-5-7-16(19)21)18(14,3)10-11-20(17)22-12-13-23-20/h6,8,16,21H,5,7,9-13H2,1-4H3/t16-,18+,19-/m1/s1 |
| InChIKey | HQIVMRXJIQTVGX-NZSAHSFTSA-N |
| XLogP | 3.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|