C28H31F2N3O4 — CID 58802380
5-acetamido-N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-hydroxybenzamide (PubChem CID 58802380) has the molecular formula C28H31F2N3O4 and a molecular weight of 511.57 g/mol. Its IUPAC name is 5-acetamido-N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-hydroxybenzamide.
| Compound Name | 5-acetamido-N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 58802380 |
| Molecular Formula | C28H31F2N3O4 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 5-acetamido-N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-hydroxybenzamide |
| SMILES | CCc1cccc(CNC[C@H](O)[C@@H](Cc2cc(F)cc(F)c2)NC(=O)c2cc(NC(C)=O)ccc2O)c1 |
| InChI | InChI=1S/C28H31F2N3O4/c1-3-18-5-4-6-19(9-18)15-31-16-27(36)25(12-20-10-21(29)13-22(30)11-20)33-28(37)24-14-23(32-17(2)34)7-8-26(24)35/h4-11,13-14,25,27,31,35-36H,3,12,15-16H2,1-2H3,(H,32,34)(H,33,37)/t25-,27+/m1/s1 |
| InChIKey | ZJQZKSTVQSZSGD-VPUSJEBWSA-N |
| XLogP | 3.68 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|