C25H30F2N6O3 — CID 58802444
N-[3-[[(2R,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]amino]-3-oxopropyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 58802444) has the molecular formula C25H30F2N6O3 and a molecular weight of 500.55 g/mol. Its IUPAC name is N-[3-[[(2R,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]amino]-3-oxopropyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[3-[[(2R,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]amino]-3-oxopropyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 58802444 |
| Molecular Formula | C25H30F2N6O3 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | N-[3-[[(2R,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]amino]-3-oxopropyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CCc1cccc(CNC[C@H](O)[C@@H](Cc2cc(F)cc(F)c2)NC(=O)CCNC(=O)c2ncn[nH]2)c1 |
| InChI | InChI=1S/C25H30F2N6O3/c1-2-16-4-3-5-17(8-16)13-28-14-22(34)21(11-18-9-19(26)12-20(27)10-18)32-23(35)6-7-29-25(36)24-30-15-31-33-24/h3-5,8-10,12,15,21-22,28,34H,2,6-7,11,13-14H2,1H3,(H,29,36)(H,32,35)(H,30,31,33)/t21-,22+/m1/s1 |
| InChIKey | QSZSKQNVZUOTNZ-YADHBBJMSA-N |
| XLogP | 1.64 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |