C27H32F2N4O3 — CID 58802892
N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-4-oxido-3-propylpyrazin-4-ium-2-carboxamide (PubChem CID 58802892) has the molecular formula C27H32F2N4O3 and a molecular weight of 498.57 g/mol. Its IUPAC name is N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-4-oxido-3-propylpyrazin-4-ium-2-carboxamide.
| Compound Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-4-oxido-3-propylpyrazin-4-ium-2-carboxamide |
|---|---|
| PubChem CID | 58802892 |
| Molecular Formula | C27H32F2N4O3 |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-4-oxido-3-propylpyrazin-4-ium-2-carboxamide |
| SMILES | CCCc1c(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@@H](O)CNCc2cccc(CC)c2)ncc[n+]1[O-] |
| InChI | InChI=1S/C27H32F2N4O3/c1-3-6-24-26(31-9-10-33(24)36)27(35)32-23(14-20-12-21(28)15-22(29)13-20)25(34)17-30-16-19-8-5-7-18(4-2)11-19/h5,7-13,15,23,25,30,34H,3-4,6,14,16-17H2,1-2H3,(H,32,35)/t23-,25-/m0/s1 |
| InChIKey | HBJQIEOIMINDRJ-ZCYQVOJMSA-N |
| XLogP | 3.00 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|