About 6-chloro-2,5-dimethyl-4H-pyrimidin-4-ide;yttrium
6-chloro-2,5-dimethyl-4H-pyrimidin-4-ide;yttrium (PubChem CID 58803006) has the molecular formula C6H6ClN2Y-
and a molecular weight of 230.49 g/mol. Its IUPAC name is 6-chloro-2,5-dimethyl-4H-pyrimidin-4-ide;yttrium.
Molecular Properties
| Compound Name | 6-chloro-2,5-dimethyl-4H-pyrimidin-4-ide;yttrium |
| PubChem CID | 58803006 |
| Molecular Formula | C6H6ClN2Y- |
| Molecular Weight | 230.49 g/mol |
| Exact Mass | 229.93 |
| IUPAC Name | 6-chloro-2,5-dimethyl-4H-pyrimidin-4-ide;yttrium |
| SMILES | Cc1n[c-]c(C)c(Cl)n1.[Y] |
| InChI | InChI=1S/C6H6ClN2.Y/c1-4-3-8-5(2)9-6(4)7;/h1-2H3;/q-1; |
| InChIKey | PEIIAMPIMWBXQH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.49 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2,5-dimethyl-4H-pyrimidin-4-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,5-dimethyl-4H-pyrimidin-4-ide;yttrium?
The IUPAC name of 6-chloro-2,5-dimethyl-4H-pyrimidin-4-ide;yttrium (CID 58803006) is 6-chloro-2,5-dimethyl-4H-pyrimidin-4-ide;yttrium.
What is the SMILES notation for 6-chloro-2,5-dimethyl-4H-pyrimidin-4-ide;yttrium?
The canonical SMILES for 6-chloro-2,5-dimethyl-4H-pyrimidin-4-ide;yttrium is Cc1n[c-]c(C)c(Cl)n1.[Y].
What is the InChIKey of 6-chloro-2,5-dimethyl-4H-pyrimidin-4-ide;yttrium?
The InChIKey is PEIIAMPIMWBXQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN2.Y/c1-4-3-8-5(2)9-6(4)7;/h1-2H3;/q-1;.
What are the key properties of 6-chloro-2,5-dimethyl-4H-pyrimidin-4-ide;yttrium?
6-chloro-2,5-dimethyl-4H-pyrimidin-4-ide;yttrium has a molecular weight of 230.49 g/mol, XLogP of 1.54, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,5-dimethyl-4H-pyrimidin-4-ide;yttrium is sourced from PubChem (CID 58803006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).