C48H27N9 — CID 58803374
2-[3,5-bis(3H-pyrrolo[3,2-f][1,7]phenanthrolin-2-yl)phenyl]-3H-pyrrolo[3,2-f][1,7]phenanthroline (PubChem CID 58803374) has the molecular formula C48H27N9 and a molecular weight of 729.81 g/mol. Its IUPAC name is 2-[3,5-bis(3H-pyrrolo[3,2-f][1,7]phenanthrolin-2-yl)phenyl]-3H-pyrrolo[3,2-f][1,7]phenanthroline.
| Compound Name | 2-[3,5-bis(3H-pyrrolo[3,2-f][1,7]phenanthrolin-2-yl)phenyl]-3H-pyrrolo[3,2-f][1,7]phenanthroline |
|---|---|
| PubChem CID | 58803374 |
| Molecular Formula | C48H27N9 |
| Molecular Weight | 729.81 g/mol |
| Exact Mass | 729.24 |
| IUPAC Name | 2-[3,5-bis(3H-pyrrolo[3,2-f][1,7]phenanthrolin-2-yl)phenyl]-3H-pyrrolo[3,2-f][1,7]phenanthroline |
| SMILES | c1cnc2c(c1)c1c(c3ncccc32)N=C(c2cc(C3=Nc4c(c5cccnc5c5cccnc45)C3)cc(C3=Nc4c(c5cccnc5c5cccnc45)C3)c2)C1 |
| InChI | InChI=1S/C48H27N9/c1-7-28-34-22-37(55-46(34)43-31(10-4-16-52-43)40(28)49-13-1)25-19-26(38-23-35-29-8-2-14-50-41(29)32-11-5-17-53-44(32)47(35)56-38)21-27(20-25)39-24-36-30-9-3-15-51-42(30)33-12-6-18-54-45(33)48(36)57-39/h1-21H,22-24H2 |
| InChIKey | DXCVRHLUSHNMCJ-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 114.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.81 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|