About 2-(triazol-1-yl)ethyl acetate
2-(triazol-1-yl)ethyl acetate (PubChem CID 58803595) has the molecular formula C6H9N3O2
and a molecular weight of 155.16 g/mol. Its IUPAC name is 2-(triazol-1-yl)ethyl acetate.
Molecular Properties
| Compound Name | 2-(triazol-1-yl)ethyl acetate |
| PubChem CID | 58803595 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 2-(triazol-1-yl)ethyl acetate |
| SMILES | CC(=O)OCCn1ccnn1 |
| InChI | InChI=1S/C6H9N3O2/c1-6(10)11-5-4-9-3-2-7-8-9/h2-3H,4-5H2,1H3 |
| InChIKey | NWZBGMYUWVKFII-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(triazol-1-yl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(triazol-1-yl)ethyl acetate?
The IUPAC name of 2-(triazol-1-yl)ethyl acetate (CID 58803595) is 2-(triazol-1-yl)ethyl acetate.
What is the SMILES notation for 2-(triazol-1-yl)ethyl acetate?
The canonical SMILES for 2-(triazol-1-yl)ethyl acetate is CC(=O)OCCn1ccnn1.
What is the InChIKey of 2-(triazol-1-yl)ethyl acetate?
The InChIKey is NWZBGMYUWVKFII-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2/c1-6(10)11-5-4-9-3-2-7-8-9/h2-3H,4-5H2,1H3.
What are the key properties of 2-(triazol-1-yl)ethyl acetate?
2-(triazol-1-yl)ethyl acetate has a molecular weight of 155.16 g/mol, XLogP of -0.16, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(triazol-1-yl)ethyl acetate is sourced from PubChem (CID 58803595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).