C26H36O2 — CID 58803773
2-[1-(2-hydroxy-3,5-dimethylphenyl)-3,7-dimethyloct-7-enyl]-4,6-dimethylphenol (PubChem CID 58803773) has the molecular formula C26H36O2 and a molecular weight of 380.57 g/mol. Its IUPAC name is 2-[1-(2-hydroxy-3,5-dimethylphenyl)-3,7-dimethyloct-7-enyl]-4,6-dimethylphenol.
| Compound Name | 2-[1-(2-hydroxy-3,5-dimethylphenyl)-3,7-dimethyloct-7-enyl]-4,6-dimethylphenol |
|---|---|
| PubChem CID | 58803773 |
| Molecular Formula | C26H36O2 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 2-[1-(2-hydroxy-3,5-dimethylphenyl)-3,7-dimethyloct-7-enyl]-4,6-dimethylphenol |
| SMILES | C=C(C)CCCC(C)CC(c1cc(C)cc(C)c1O)c1cc(C)cc(C)c1O |
| InChI | InChI=1S/C26H36O2/c1-16(2)9-8-10-17(3)13-22(23-14-18(4)11-20(6)25(23)27)24-15-19(5)12-21(7)26(24)28/h11-12,14-15,17,22,27-28H,1,8-10,13H2,2-7H3 |
| InChIKey | FTNFGZWVTVPZSF-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|