C43H37N2O4S2+ — CID 58803794
3-(2-phenoxyethyl)-2-[2-[[3-(2-phenoxyethyl)-5-thiophen-2-yl-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-5-thiophen-2-yl-1,3-benzoxazole (PubChem CID 58803794) has the molecular formula C43H37N2O4S2+ and a molecular weight of 709.91 g/mol. Its IUPAC name is 3-(2-phenoxyethyl)-2-[2-[[3-(2-phenoxyethyl)-5-thiophen-2-yl-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-5-thiophen-2-yl-1,3-benzoxazole.
| Compound Name | 3-(2-phenoxyethyl)-2-[2-[[3-(2-phenoxyethyl)-5-thiophen-2-yl-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-5-thiophen-2-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 58803794 |
| Molecular Formula | C43H37N2O4S2+ |
| Molecular Weight | 709.91 g/mol |
| Exact Mass | 709.22 |
| IUPAC Name | 3-(2-phenoxyethyl)-2-[2-[[3-(2-phenoxyethyl)-5-thiophen-2-yl-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-5-thiophen-2-yl-1,3-benzoxazole |
| SMILES | CCC(=Cc1oc2ccc(-c3cccs3)cc2[n+]1CCOc1ccccc1)C=C1Oc2ccc(-c3cccs3)cc2N1CCOc1ccccc1 |
| InChI | InChI=1S/C43H37N2O4S2/c1-2-31(27-42-44(21-23-46-34-11-5-3-6-12-34)36-29-32(17-19-38(36)48-42)40-15-9-25-50-40)28-43-45(22-24-47-35-13-7-4-8-14-35)37-30-33(18-20-39(37)49-43)41-16-10-26-51-41/h3-20,25-30H,2,21-24H2,1H3/q+1 |
| InChIKey | MWPHWDBGNVIORY-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 47.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.91 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|