C41H34N2O8S2 — CID 58803813
2-[[2-[2-[[3-[[2-(trioxidanylsulfanyl)phenyl]methyl]benzo[f][1,3]benzoxazol-2-ylidene]methyl]but-1-enyl]-2H-benzo[f][1,3]benzoxazol-3-yl]methyl]benzenesulfonic acid (PubChem CID 58803813) has the molecular formula C41H34N2O8S2 and a molecular weight of 746.86 g/mol. Its IUPAC name is 2-[[2-[2-[[3-[[2-(trioxidanylsulfanyl)phenyl]methyl]benzo[f][1,3]benzoxazol-2-ylidene]methyl]but-1-enyl]-2H-benzo[f][1,3]benzoxazol-3-yl]methyl]benzenesulfonic acid.
| Compound Name | 2-[[2-[2-[[3-[[2-(trioxidanylsulfanyl)phenyl]methyl]benzo[f][1,3]benzoxazol-2-ylidene]methyl]but-1-enyl]-2H-benzo[f][1,3]benzoxazol-3-yl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 58803813 |
| Molecular Formula | C41H34N2O8S2 |
| Molecular Weight | 746.86 g/mol |
| Exact Mass | 746.18 |
| IUPAC Name | 2-[[2-[2-[[3-[[2-(trioxidanylsulfanyl)phenyl]methyl]benzo[f][1,3]benzoxazol-2-ylidene]methyl]but-1-enyl]-2H-benzo[f][1,3]benzoxazol-3-yl]methyl]benzenesulfonic acid |
| SMILES | CCC(=CC1Oc2cc3ccccc3cc2N1Cc1ccccc1S(=O)(=O)O)C=C1Oc2cc3ccccc3cc2N1Cc1ccccc1SOOO |
| InChI | InChI=1S/C41H34N2O8S2/c1-2-27(19-40-42(25-32-15-7-9-17-38(32)52-51-50-44)34-21-28-11-3-5-13-30(28)23-36(34)48-40)20-41-43(26-33-16-8-10-18-39(33)53(45,46)47)35-22-29-12-4-6-14-31(29)24-37(35)49-41/h3-24,41,44H,2,25-26H2,1H3,(H,45,46,47) |
| InChIKey | FZKUGEVXHGORDU-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.86 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|