About 5-methyl-2-azabicyclo[5.1.0]octa-1(7),2,4-triene
5-methyl-2-azabicyclo[5.1.0]octa-1(7),2,4-triene (PubChem CID 58803829) has the molecular formula C8H9N
and a molecular weight of 119.17 g/mol. Its IUPAC name is 5-methyl-2-azabicyclo[5.1.0]octa-1(7),2,4-triene.
Molecular Properties
| Compound Name | 5-methyl-2-azabicyclo[5.1.0]octa-1(7),2,4-triene |
| PubChem CID | 58803829 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 5-methyl-2-azabicyclo[5.1.0]octa-1(7),2,4-triene |
| SMILES | CC1=CC=NC2=C(C1)C2 |
| InChI | InChI=1S/C8H9N/c1-6-2-3-9-8-5-7(8)4-6/h2-3H,4-5H2,1H3 |
| InChIKey | FVBAGSKSLDCUDQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methyl-2-azabicyclo[5.1.0]octa-1(7),2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-azabicyclo[5.1.0]octa-1(7),2,4-triene?
The IUPAC name of 5-methyl-2-azabicyclo[5.1.0]octa-1(7),2,4-triene (CID 58803829) is 5-methyl-2-azabicyclo[5.1.0]octa-1(7),2,4-triene.
What is the SMILES notation for 5-methyl-2-azabicyclo[5.1.0]octa-1(7),2,4-triene?
The canonical SMILES for 5-methyl-2-azabicyclo[5.1.0]octa-1(7),2,4-triene is CC1=CC=NC2=C(C1)C2.
What is the InChIKey of 5-methyl-2-azabicyclo[5.1.0]octa-1(7),2,4-triene?
The InChIKey is FVBAGSKSLDCUDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N/c1-6-2-3-9-8-5-7(8)4-6/h2-3H,4-5H2,1H3.
What are the key properties of 5-methyl-2-azabicyclo[5.1.0]octa-1(7),2,4-triene?
5-methyl-2-azabicyclo[5.1.0]octa-1(7),2,4-triene has a molecular weight of 119.17 g/mol, XLogP of 2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-azabicyclo[5.1.0]octa-1(7),2,4-triene is sourced from PubChem (CID 58803829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).