C26H27N5O9 — CID 58803921
N-[(5S,5aS,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-1,5,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydrotetracen-2-yl]imidazole-1-carboxamide (PubChem CID 58803921) has the molecular formula C26H27N5O9 and a molecular weight of 553.53 g/mol. Its IUPAC name is N-[(5S,5aS,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-1,5,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydrotetracen-2-yl]imidazole-1-carboxamide.
| Compound Name | N-[(5S,5aS,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-1,5,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydrotetracen-2-yl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 58803921 |
| Molecular Formula | C26H27N5O9 |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | N-[(5S,5aS,6aS,7S,10aR)-9-carbamoyl-7-(dimethylamino)-1,5,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydrotetracen-2-yl]imidazole-1-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(ccc(NC(=O)n5ccnc5)c4O)[C@@](C)(O)[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C26H27N5O9/c1-25(39)10-4-5-13(29-24(38)31-7-6-28-9-31)18(32)14(10)19(33)15-11(25)8-12-17(30(2)3)20(34)16(23(27)37)22(36)26(12,40)21(15)35/h4-7,9,11-12,17,32-33,36,39-40H,8H2,1-3H3,(H2,27,37)(H,29,38)/t11-,12-,17-,25+,26-/m0/s1 |
| InChIKey | NNIXSOAPBNGGTC-MCOBEHLASA-N |
| XLogP | -0.09 |
| TPSA | 228.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|