C32H27F2N5 — CID 58804263
1-[5-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]-2-pyridinyl]-4-(2-isocyanophenyl)piperazine (PubChem CID 58804263) has the molecular formula C32H27F2N5 and a molecular weight of 519.60 g/mol. Its IUPAC name is 1-[5-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]-2-pyridinyl]-4-(2-isocyanophenyl)piperazine.
| Compound Name | 1-[5-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]-2-pyridinyl]-4-(2-isocyanophenyl)piperazine |
|---|---|
| PubChem CID | 58804263 |
| Molecular Formula | C32H27F2N5 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 1-[5-[4-[5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]phenyl]-2-pyridinyl]-4-(2-isocyanophenyl)piperazine |
| SMILES | [C-]#[N+]c1ccccc1N1CCN(c2ccc(-c3ccc(C4CCC(c5c(F)cccc5F)=N4)cc3)cn2)CC1 |
| InChI | InChI=1S/C32H27F2N5/c1-35-28-7-2-3-8-30(28)38-17-19-39(20-18-38)31-16-13-24(21-36-31)22-9-11-23(12-10-22)27-14-15-29(37-27)32-25(33)5-4-6-26(32)34/h2-13,16,21,27H,14-15,17-20H2 |
| InChIKey | WGLFVRXJCYOIGF-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 36.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|