C8H9F5N2O2 — CID 588045
5-(2,2,3,3,3-pentafluoro-1,1-dimethoxypropyl)-1H-imidazole (PubChem CID 588045) has the molecular formula C8H9F5N2O2 and a molecular weight of 260.16 g/mol. Its IUPAC name is 5-(2,2,3,3,3-pentafluoro-1,1-dimethoxypropyl)-1H-imidazole.
| Compound Name | 5-(2,2,3,3,3-pentafluoro-1,1-dimethoxypropyl)-1H-imidazole |
|---|---|
| PubChem CID | 588045 |
| Molecular Formula | C8H9F5N2O2 |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 5-(2,2,3,3,3-pentafluoro-1,1-dimethoxypropyl)-1H-imidazole |
| SMILES | COC(OC)(c1cnc[nH]1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F5N2O2/c1-16-6(17-2,5-3-14-4-15-5)7(9,10)8(11,12)13/h3-4H,1-2H3,(H,14,15) |
| InChIKey | FECLCVPOFXSDQQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|