C18H18F5N3O2S — CID 58804992
(2,3,4,5,6-pentafluorophenyl) 4-(methylamino)-2-[(4-methylpiperidin-1-yl)methyl]-1,3-thiazole-5-carboxylate (PubChem CID 58804992) has the molecular formula C18H18F5N3O2S and a molecular weight of 435.42 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-(methylamino)-2-[(4-methylpiperidin-1-yl)methyl]-1,3-thiazole-5-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-(methylamino)-2-[(4-methylpiperidin-1-yl)methyl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 58804992 |
| Molecular Formula | C18H18F5N3O2S |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-(methylamino)-2-[(4-methylpiperidin-1-yl)methyl]-1,3-thiazole-5-carboxylate |
| SMILES | CNc1nc(CN2CCC(C)CC2)sc1C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H18F5N3O2S/c1-8-3-5-26(6-4-8)7-9-25-17(24-2)16(29-9)18(27)28-15-13(22)11(20)10(19)12(21)14(15)23/h8,24H,3-7H2,1-2H3 |
| InChIKey | BIFPFPHYJVWXPF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|