About [(E)-5-carbamoyloxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate
[(E)-5-carbamoyloxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate (PubChem CID 58805110) has the molecular formula C11H18N2O4
and a molecular weight of 242.27 g/mol. Its IUPAC name is [(E)-5-carbamoyloxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | [(E)-5-carbamoyloxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate |
| PubChem CID | 58805110 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | [(E)-5-carbamoyloxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate |
| SMILES | C=C(/C=C/COC(N)=O)COC(=O)NC(C)C |
| InChI | InChI=1S/C11H18N2O4/c1-8(2)13-11(15)17-7-9(3)5-4-6-16-10(12)14/h4-5,8H,3,6-7H2,1-2H3,(H2,12,14)(H,13,15)/b5-4+ |
| InChIKey | FQJJEOUFEPFKJH-SNAWJCMRSA-N |
| XLogP | 1.33 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-5-carbamoyloxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-5-carbamoyloxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate?
The IUPAC name of [(E)-5-carbamoyloxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate (CID 58805110) is [(E)-5-carbamoyloxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate.
What is the SMILES notation for [(E)-5-carbamoyloxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate?
The canonical SMILES for [(E)-5-carbamoyloxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate is C=C(/C=C/COC(N)=O)COC(=O)NC(C)C.
What is the InChIKey of [(E)-5-carbamoyloxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate?
The InChIKey is FQJJEOUFEPFKJH-SNAWJCMRSA-N. The full InChI is InChI=1S/C11H18N2O4/c1-8(2)13-11(15)17-7-9(3)5-4-6-16-10(12)14/h4-5,8H,3,6-7H2,1-2H3,(H2,12,14)(H,13,15)/b5-4+.
What are the key properties of [(E)-5-carbamoyloxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate?
[(E)-5-carbamoyloxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate has a molecular weight of 242.27 g/mol, XLogP of 1.33, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-5-carbamoyloxy-2-methylidenepent-3-enyl] N-propan-2-ylcarbamate is sourced from PubChem (CID 58805110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).