About [3-(hydroxymethyl)-2-methylidenebut-3-enyl] N-propan-2-ylcarbamate
[3-(hydroxymethyl)-2-methylidenebut-3-enyl] N-propan-2-ylcarbamate (PubChem CID 58805121) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is [3-(hydroxymethyl)-2-methylidenebut-3-enyl] N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | [3-(hydroxymethyl)-2-methylidenebut-3-enyl] N-propan-2-ylcarbamate |
| PubChem CID | 58805121 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | [3-(hydroxymethyl)-2-methylidenebut-3-enyl] N-propan-2-ylcarbamate |
| SMILES | C=C(CO)C(=C)COC(=O)NC(C)C |
| InChI | InChI=1S/C10H17NO3/c1-7(2)11-10(13)14-6-9(4)8(3)5-12/h7,12H,3-6H2,1-2H3,(H,11,13) |
| InChIKey | YIHWSRQXKOEXRA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [3-(hydroxymethyl)-2-methylidenebut-3-enyl] N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(hydroxymethyl)-2-methylidenebut-3-enyl] N-propan-2-ylcarbamate?
The IUPAC name of [3-(hydroxymethyl)-2-methylidenebut-3-enyl] N-propan-2-ylcarbamate (CID 58805121) is [3-(hydroxymethyl)-2-methylidenebut-3-enyl] N-propan-2-ylcarbamate.
What is the SMILES notation for [3-(hydroxymethyl)-2-methylidenebut-3-enyl] N-propan-2-ylcarbamate?
The canonical SMILES for [3-(hydroxymethyl)-2-methylidenebut-3-enyl] N-propan-2-ylcarbamate is C=C(CO)C(=C)COC(=O)NC(C)C.
What is the InChIKey of [3-(hydroxymethyl)-2-methylidenebut-3-enyl] N-propan-2-ylcarbamate?
The InChIKey is YIHWSRQXKOEXRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-7(2)11-10(13)14-6-9(4)8(3)5-12/h7,12H,3-6H2,1-2H3,(H,11,13).
What are the key properties of [3-(hydroxymethyl)-2-methylidenebut-3-enyl] N-propan-2-ylcarbamate?
[3-(hydroxymethyl)-2-methylidenebut-3-enyl] N-propan-2-ylcarbamate has a molecular weight of 199.25 g/mol, XLogP of 1.23, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(hydroxymethyl)-2-methylidenebut-3-enyl] N-propan-2-ylcarbamate is sourced from PubChem (CID 58805121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).