C24H33N3O3S — CID 58805259
N-[(2R,3R)-4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylsulfanylbutan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 58805259) has the molecular formula C24H33N3O3S and a molecular weight of 443.61 g/mol. Its IUPAC name is N-[(2R,3R)-4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylsulfanylbutan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(2R,3R)-4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylsulfanylbutan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 58805259 |
| Molecular Formula | C24H33N3O3S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-[(2R,3R)-4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylsulfanylbutan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@@H](CSc2ccccc2)[C@H](O)CN2CC[C@@H]3CCCC[C@@H]3C2)no1 |
| InChI | InChI=1S/C24H33N3O3S/c1-17-13-21(26-30-17)24(29)25-22(16-31-20-9-3-2-4-10-20)23(28)15-27-12-11-18-7-5-6-8-19(18)14-27/h2-4,9-10,13,18-19,22-23,28H,5-8,11-12,14-16H2,1H3,(H,25,29)/t18-,19+,22-,23+/m0/s1 |
| InChIKey | MSTNRJVZIZXQGD-JFSTXAPLSA-N |
| XLogP | 3.75 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |