C28H38N4O6S — CID 58805270
(4R)-3-[(2S,3S)-3-[(3,4-dimethoxyphenyl)methylcarbamoylamino]-2-hydroxybutanoyl]-5,5-dimethyl-N-[(2-methylphenyl)methyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 58805270) has the molecular formula C28H38N4O6S and a molecular weight of 558.70 g/mol. Its IUPAC name is (4R)-3-[(2S,3S)-3-[(3,4-dimethoxyphenyl)methylcarbamoylamino]-2-hydroxybutanoyl]-5,5-dimethyl-N-[(2-methylphenyl)methyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-3-[(2S,3S)-3-[(3,4-dimethoxyphenyl)methylcarbamoylamino]-2-hydroxybutanoyl]-5,5-dimethyl-N-[(2-methylphenyl)methyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 58805270 |
| Molecular Formula | C28H38N4O6S |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | (4R)-3-[(2S,3S)-3-[(3,4-dimethoxyphenyl)methylcarbamoylamino]-2-hydroxybutanoyl]-5,5-dimethyl-N-[(2-methylphenyl)methyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | COc1ccc(CNC(=O)N[C@@H](C)[C@H](O)C(=O)N2CSC(C)(C)[C@H]2C(=O)NCc2ccccc2C)cc1OC |
| InChI | InChI=1S/C28H38N4O6S/c1-17-9-7-8-10-20(17)15-29-25(34)24-28(3,4)39-16-32(24)26(35)23(33)18(2)31-27(36)30-14-19-11-12-21(37-5)22(13-19)38-6/h7-13,18,23-24,33H,14-16H2,1-6H3,(H,29,34)(H2,30,31,36)/t18-,23-,24+/m0/s1 |
| InChIKey | QWFXWYVVKFDCQF-GKVQRAMASA-N |
| XLogP | 2.56 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |