C8H14O4Si — CID 58805452
(1S,2R,3S)-4-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol (PubChem CID 58805452) has the molecular formula C8H14O4Si and a molecular weight of 202.28 g/mol. Its IUPAC name is (1S,2R,3S)-4-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol.
| Compound Name | (1S,2R,3S)-4-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol |
|---|---|
| PubChem CID | 58805452 |
| Molecular Formula | C8H14O4Si |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | (1S,2R,3S)-4-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol |
| SMILES | C[Si](C)(O)C1=CC2O[C@H]2[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H14O4Si/c1-13(2,11)5-3-4-8(12-4)7(10)6(5)9/h3-4,6-11H,1-2H3/t4?,6-,7-,8-/m1/s1 |
| InChIKey | BYIHXULQFYHJAI-NPPIPOFDSA-N |
| XLogP | -0.85 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|