C10H14O3 — CID 58805459
(3aR,6bR)-2,2,4-trimethyl-3a,5a,6a,6b-tetrahydrooxireno[2,3-g][1,3]benzodioxole (PubChem CID 58805459) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (3aR,6bR)-2,2,4-trimethyl-3a,5a,6a,6b-tetrahydrooxireno[2,3-g][1,3]benzodioxole.
| Compound Name | (3aR,6bR)-2,2,4-trimethyl-3a,5a,6a,6b-tetrahydrooxireno[2,3-g][1,3]benzodioxole |
|---|---|
| PubChem CID | 58805459 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (3aR,6bR)-2,2,4-trimethyl-3a,5a,6a,6b-tetrahydrooxireno[2,3-g][1,3]benzodioxole |
| SMILES | CC1=CC2OC2[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C10H14O3/c1-5-4-6-8(11-6)9-7(5)12-10(2,3)13-9/h4,6-9H,1-3H3/t6?,7-,8?,9-/m1/s1 |
| InChIKey | KUBMHQPJAGQEOK-SRKTWWLUSA-N |
| XLogP | 1.23 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|