C11H18O4Si — CID 58805464
[(3aS,6aR,6bS)-2,2-dimethyl-3a,5a,6a,6b-tetrahydrooxireno[2,3-g][1,3]benzodioxol-4-yl]-hydroxy-dimethylsilane (PubChem CID 58805464) has the molecular formula C11H18O4Si and a molecular weight of 242.35 g/mol. Its IUPAC name is [(3aS,6aR,6bS)-2,2-dimethyl-3a,5a,6a,6b-tetrahydrooxireno[2,3-g][1,3]benzodioxol-4-yl]-hydroxy-dimethylsilane.
| Compound Name | [(3aS,6aR,6bS)-2,2-dimethyl-3a,5a,6a,6b-tetrahydrooxireno[2,3-g][1,3]benzodioxol-4-yl]-hydroxy-dimethylsilane |
|---|---|
| PubChem CID | 58805464 |
| Molecular Formula | C11H18O4Si |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | [(3aS,6aR,6bS)-2,2-dimethyl-3a,5a,6a,6b-tetrahydrooxireno[2,3-g][1,3]benzodioxol-4-yl]-hydroxy-dimethylsilane |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)C([Si](C)(C)O)=CC1O[C@H]12 |
| InChI | InChI=1S/C11H18O4Si/c1-11(2)14-9-7(16(3,4)12)5-6-8(13-6)10(9)15-11/h5-6,8-10,12H,1-4H3/t6?,8-,9-,10+/m1/s1 |
| InChIKey | LCLDNHWAGSDNGF-DTGIGOFRSA-N |
| XLogP | 0.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|