About (2S,3S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol
(2S,3S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol (PubChem CID 58805469) has the molecular formula C8H14O4Si
and a molecular weight of 202.28 g/mol. Its IUPAC name is (2S,3S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol.
Molecular Properties
| Compound Name | (2S,3S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol |
| PubChem CID | 58805469 |
| Molecular Formula | C8H14O4Si |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | (2S,3S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol |
| SMILES | C[Si](C)(O)C12OC1C=C[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C8H14O4Si/c1-13(2,11)8-6(12-8)4-3-5(9)7(8)10/h3-7,9-11H,1-2H3/t5-,6?,7-,8?/m0/s1 |
| InChIKey | UPWZBAXCWSZWQX-DNBGNTRDSA-N |
| XLogP | -0.85 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol?
The IUPAC name of (2S,3S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol (CID 58805469) is (2S,3S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol.
What is the SMILES notation for (2S,3S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol?
The canonical SMILES for (2S,3S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol is C[Si](C)(O)C12OC1C=C[C@H](O)[C@@H]2O.
What is the InChIKey of (2S,3S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol?
The InChIKey is UPWZBAXCWSZWQX-DNBGNTRDSA-N. The full InChI is InChI=1S/C8H14O4Si/c1-13(2,11)8-6(12-8)4-3-5(9)7(8)10/h3-7,9-11H,1-2H3/t5-,6?,7-,8?/m0/s1.
What are the key properties of (2S,3S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol?
(2S,3S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol has a molecular weight of 202.28 g/mol, XLogP of -0.85, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-1-[hydroxy(dimethyl)silyl]-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol is sourced from PubChem (CID 58805469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).