About 2-(1-chloroethyl)-1,3-difluorobenzene
2-(1-chloroethyl)-1,3-difluorobenzene (PubChem CID 588055) has the molecular formula C8H7ClF2
and a molecular weight of 176.59 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1,3-difluorobenzene.
Molecular Properties
| Compound Name | 2-(1-chloroethyl)-1,3-difluorobenzene |
| PubChem CID | 588055 |
| Molecular Formula | C8H7ClF2 |
| Molecular Weight | 176.59 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | 2-(1-chloroethyl)-1,3-difluorobenzene |
| SMILES | CC(Cl)c1c(F)cccc1F |
| InChI | InChI=1S/C8H7ClF2/c1-5(9)8-6(10)3-2-4-7(8)11/h2-5H,1H3 |
| InChIKey | HHKQNNWJZXDJBH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.59 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-chloroethyl)-1,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-chloroethyl)-1,3-difluorobenzene?
The IUPAC name of 2-(1-chloroethyl)-1,3-difluorobenzene (CID 588055) is 2-(1-chloroethyl)-1,3-difluorobenzene.
What is the SMILES notation for 2-(1-chloroethyl)-1,3-difluorobenzene?
The canonical SMILES for 2-(1-chloroethyl)-1,3-difluorobenzene is CC(Cl)c1c(F)cccc1F.
What is the InChIKey of 2-(1-chloroethyl)-1,3-difluorobenzene?
The InChIKey is HHKQNNWJZXDJBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClF2/c1-5(9)8-6(10)3-2-4-7(8)11/h2-5H,1H3.
What are the key properties of 2-(1-chloroethyl)-1,3-difluorobenzene?
2-(1-chloroethyl)-1,3-difluorobenzene has a molecular weight of 176.59 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-chloroethyl)-1,3-difluorobenzene is sourced from PubChem (CID 588055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).