C35H50O4 — CID 58805631
[10,13-dimethyl-17-(5-oxohexan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 58805631) has the molecular formula C35H50O4 and a molecular weight of 534.78 g/mol. Its IUPAC name is [10,13-dimethyl-17-(5-oxohexan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [10,13-dimethyl-17-(5-oxohexan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 58805631 |
| Molecular Formula | C35H50O4 |
| Molecular Weight | 534.78 g/mol |
| Exact Mass | 534.37 |
| IUPAC Name | [10,13-dimethyl-17-(5-oxohexan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OC2CCC3(C)C(CCC4C3CCC3(C)C(C(C)CCC(C)=O)CCC43)C2)cc1 |
| InChI | InChI=1S/C35H50O4/c1-23(6-7-24(2)36)30-15-16-31-29-14-11-26-22-28(18-20-34(26,3)32(29)19-21-35(30,31)4)39-33(37)17-10-25-8-12-27(38-5)13-9-25/h8-10,12-13,17,23,26,28-32H,6-7,11,14-16,18-22H2,1-5H3/b17-10+ |
| InChIKey | ZRFNZUDKWWCSHL-LICLKQGHSA-N |
| XLogP | 8.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.78 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|