C27H28 — CID 58805648
2',7'-dimethyl-9,9'-spirobi[4,4a,4b,8a-tetrahydrofluorene] (PubChem CID 58805648) has the molecular formula C27H28 and a molecular weight of 352.52 g/mol. Its IUPAC name is 2',7'-dimethyl-9,9'-spirobi[4,4a,4b,8a-tetrahydrofluorene].
| Compound Name | 2',7'-dimethyl-9,9'-spirobi[4,4a,4b,8a-tetrahydrofluorene] |
|---|---|
| PubChem CID | 58805648 |
| Molecular Formula | C27H28 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 2',7'-dimethyl-9,9'-spirobi[4,4a,4b,8a-tetrahydrofluorene] |
| SMILES | CC1=CCC2C(=C1)C1(C3=CC=CCC3C3C=CC=CC31)C1C=C(C)C=CC21 |
| InChI | InChI=1S/C27H28/c1-17-11-13-21-22-14-12-18(2)16-26(22)27(25(21)15-17)23-9-5-3-7-19(23)20-8-4-6-10-24(20)27/h3-7,9-13,15-16,19-23,25H,8,14H2,1-2H3 |
| InChIKey | JRTKZPBLUPKPOG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |