About 3,4-dimethoxy-1,1-dimethylcyclopentane
3,4-dimethoxy-1,1-dimethylcyclopentane (PubChem CID 58806283) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is 3,4-dimethoxy-1,1-dimethylcyclopentane.
Molecular Properties
| Compound Name | 3,4-dimethoxy-1,1-dimethylcyclopentane |
| PubChem CID | 58806283 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 3,4-dimethoxy-1,1-dimethylcyclopentane |
| SMILES | COC1CC(C)(C)CC1OC |
| InChI | InChI=1S/C9H18O2/c1-9(2)5-7(10-3)8(6-9)11-4/h7-8H,5-6H2,1-4H3 |
| InChIKey | QOANCRWOLXYFHS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dimethoxy-1,1-dimethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethoxy-1,1-dimethylcyclopentane?
The IUPAC name of 3,4-dimethoxy-1,1-dimethylcyclopentane (CID 58806283) is 3,4-dimethoxy-1,1-dimethylcyclopentane.
What is the SMILES notation for 3,4-dimethoxy-1,1-dimethylcyclopentane?
The canonical SMILES for 3,4-dimethoxy-1,1-dimethylcyclopentane is COC1CC(C)(C)CC1OC.
What is the InChIKey of 3,4-dimethoxy-1,1-dimethylcyclopentane?
The InChIKey is QOANCRWOLXYFHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-9(2)5-7(10-3)8(6-9)11-4/h7-8H,5-6H2,1-4H3.
What are the key properties of 3,4-dimethoxy-1,1-dimethylcyclopentane?
3,4-dimethoxy-1,1-dimethylcyclopentane has a molecular weight of 158.24 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethoxy-1,1-dimethylcyclopentane is sourced from PubChem (CID 58806283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).