C19H16F5N3O2 — CID 58806562
2-[4-[1-(6-methoxy-3-pyridinyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]phenyl]ethanol (PubChem CID 58806562) has the molecular formula C19H16F5N3O2 and a molecular weight of 413.35 g/mol. Its IUPAC name is 2-[4-[1-(6-methoxy-3-pyridinyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]phenyl]ethanol.
| Compound Name | 2-[4-[1-(6-methoxy-3-pyridinyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]phenyl]ethanol |
|---|---|
| PubChem CID | 58806562 |
| Molecular Formula | C19H16F5N3O2 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-[4-[1-(6-methoxy-3-pyridinyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]phenyl]ethanol |
| SMILES | COc1ccc(-n2nc(C(F)(F)C(F)(F)F)cc2-c2ccc(CCO)cc2)cn1 |
| InChI | InChI=1S/C19H16F5N3O2/c1-29-17-7-6-14(11-25-17)27-15(13-4-2-12(3-5-13)8-9-28)10-16(26-27)18(20,21)19(22,23)24/h2-7,10-11,28H,8-9H2,1H3 |
| InChIKey | FITKXHAZQWEMLT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|