C20H17F5N2O2 — CID 58806663
2-[4-[1-(4-methoxyphenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]phenyl]ethanol (PubChem CID 58806663) has the molecular formula C20H17F5N2O2 and a molecular weight of 412.36 g/mol. Its IUPAC name is 2-[4-[1-(4-methoxyphenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]phenyl]ethanol.
| Compound Name | 2-[4-[1-(4-methoxyphenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]phenyl]ethanol |
|---|---|
| PubChem CID | 58806663 |
| Molecular Formula | C20H17F5N2O2 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 2-[4-[1-(4-methoxyphenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]phenyl]ethanol |
| SMILES | COc1ccc(-n2nc(C(F)(F)C(F)(F)F)cc2-c2ccc(CCO)cc2)cc1 |
| InChI | InChI=1S/C20H17F5N2O2/c1-29-16-8-6-15(7-9-16)27-17(14-4-2-13(3-5-14)10-11-28)12-18(26-27)19(21,22)20(23,24)25/h2-9,12,28H,10-11H2,1H3 |
| InChIKey | YJLCWXRWVYFCNB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|