About 2,5-dimethylthieno[2,3-b]thiophene
2,5-dimethylthieno[2,3-b]thiophene (PubChem CID 58807308) has the molecular formula C8H8S2
and a molecular weight of 168.29 g/mol. Its IUPAC name is 2,5-dimethylthieno[2,3-b]thiophene.
Molecular Properties
| Compound Name | 2,5-dimethylthieno[2,3-b]thiophene |
| PubChem CID | 58807308 |
| Molecular Formula | C8H8S2 |
| Molecular Weight | 168.29 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 2,5-dimethylthieno[2,3-b]thiophene |
| SMILES | Cc1cc2cc(C)sc2s1 |
| InChI | InChI=1S/C8H8S2/c1-5-3-7-4-6(2)10-8(7)9-5/h3-4H,1-2H3 |
| InChIKey | WKUFJALRQMNTRW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dimethylthieno[2,3-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylthieno[2,3-b]thiophene?
The IUPAC name of 2,5-dimethylthieno[2,3-b]thiophene (CID 58807308) is 2,5-dimethylthieno[2,3-b]thiophene.
What is the SMILES notation for 2,5-dimethylthieno[2,3-b]thiophene?
The canonical SMILES for 2,5-dimethylthieno[2,3-b]thiophene is Cc1cc2cc(C)sc2s1.
What is the InChIKey of 2,5-dimethylthieno[2,3-b]thiophene?
The InChIKey is WKUFJALRQMNTRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8S2/c1-5-3-7-4-6(2)10-8(7)9-5/h3-4H,1-2H3.
What are the key properties of 2,5-dimethylthieno[2,3-b]thiophene?
2,5-dimethylthieno[2,3-b]thiophene has a molecular weight of 168.29 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylthieno[2,3-b]thiophene is sourced from PubChem (CID 58807308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).