About 2,3,5,6-tetrahydrothieno[3,4-b][1,4,7]trioxonine
2,3,5,6-tetrahydrothieno[3,4-b][1,4,7]trioxonine (PubChem CID 58807327) has the molecular formula C8H10O3S
and a molecular weight of 186.23 g/mol. Its IUPAC name is 2,3,5,6-tetrahydrothieno[3,4-b][1,4,7]trioxonine.
Analyze 2,3,5,6-tetrahydrothieno[3,4-b][1,4,7]trioxonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5,6-tetrahydrothieno[3,4-b][1,4,7]trioxonine?
The IUPAC name of 2,3,5,6-tetrahydrothieno[3,4-b][1,4,7]trioxonine (CID 58807327) is 2,3,5,6-tetrahydrothieno[3,4-b][1,4,7]trioxonine.
What is the SMILES notation for 2,3,5,6-tetrahydrothieno[3,4-b][1,4,7]trioxonine?
The canonical SMILES for 2,3,5,6-tetrahydrothieno[3,4-b][1,4,7]trioxonine is c1scc2c1OCCOCCO2.
What is the InChIKey of 2,3,5,6-tetrahydrothieno[3,4-b][1,4,7]trioxonine?
The InChIKey is TVELHPABJYRNDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3S/c1-3-10-7-5-12-6-8(7)11-4-2-9-1/h5-6H,1-4H2.
What are the key properties of 2,3,5,6-tetrahydrothieno[3,4-b][1,4,7]trioxonine?
2,3,5,6-tetrahydrothieno[3,4-b][1,4,7]trioxonine has a molecular weight of 186.23 g/mol, XLogP of 1.54, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5,6-tetrahydrothieno[3,4-b][1,4,7]trioxonine is sourced from PubChem (CID 58807327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).