About 2,3,4,5-tetramethoxyhexane
2,3,4,5-tetramethoxyhexane (PubChem CID 58807580) has the molecular formula C10H22O4
and a molecular weight of 206.28 g/mol. Its IUPAC name is 2,3,4,5-tetramethoxyhexane.
Molecular Properties
| Compound Name | 2,3,4,5-tetramethoxyhexane |
| PubChem CID | 58807580 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2,3,4,5-tetramethoxyhexane |
| SMILES | COC(C)C(OC)C(OC)C(C)OC |
| InChI | InChI=1S/C10H22O4/c1-7(11-3)9(13-5)10(14-6)8(2)12-4/h7-10H,1-6H3 |
| InChIKey | ZLBOWOHTXOWQFO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3,4,5-tetramethoxyhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetramethoxyhexane?
The IUPAC name of 2,3,4,5-tetramethoxyhexane (CID 58807580) is 2,3,4,5-tetramethoxyhexane.
What is the SMILES notation for 2,3,4,5-tetramethoxyhexane?
The canonical SMILES for 2,3,4,5-tetramethoxyhexane is COC(C)C(OC)C(OC)C(C)OC.
What is the InChIKey of 2,3,4,5-tetramethoxyhexane?
The InChIKey is ZLBOWOHTXOWQFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O4/c1-7(11-3)9(13-5)10(14-6)8(2)12-4/h7-10H,1-6H3.
What are the key properties of 2,3,4,5-tetramethoxyhexane?
2,3,4,5-tetramethoxyhexane has a molecular weight of 206.28 g/mol, XLogP of 1.09, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetramethoxyhexane is sourced from PubChem (CID 58807580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).