About (1S)-5-phenylspiro[4-oxa-6-azatricyclo[6.3.0.02,6]undecane-10,1'-cyclopropane]-7-one
(1S)-5-phenylspiro[4-oxa-6-azatricyclo[6.3.0.02,6]undecane-10,1'-cyclopropane]-7-one (PubChem CID 58807843) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is (1S)-5-phenylspiro[4-oxa-6-azatricyclo[6.3.0.02,6]undecane-10,1'-cyclopropane]-7-one.
Molecular Properties
| Compound Name | (1S)-5-phenylspiro[4-oxa-6-azatricyclo[6.3.0.02,6]undecane-10,1'-cyclopropane]-7-one |
| PubChem CID | 58807843 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (1S)-5-phenylspiro[4-oxa-6-azatricyclo[6.3.0.02,6]undecane-10,1'-cyclopropane]-7-one |
| SMILES | O=C1C2CC3(CC3)C[C@@H]2C2COC(c3ccccc3)N12 |
| InChI | InChI=1S/C17H19NO2/c19-15-13-9-17(6-7-17)8-12(13)14-10-20-16(18(14)15)11-4-2-1-3-5-11/h1-5,12-14,16H,6-10H2/t12-,13?,14?,16?/m0/s1 |
| InChIKey | JJUMUPUULUQELU-BAYAOMGESA-N |
| XLogP | 2.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-5-phenylspiro[4-oxa-6-azatricyclo[6.3.0.02,6]undecane-10,1'-cyclopropane]-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-5-phenylspiro[4-oxa-6-azatricyclo[6.3.0.02,6]undecane-10,1'-cyclopropane]-7-one?
The IUPAC name of (1S)-5-phenylspiro[4-oxa-6-azatricyclo[6.3.0.02,6]undecane-10,1'-cyclopropane]-7-one (CID 58807843) is (1S)-5-phenylspiro[4-oxa-6-azatricyclo[6.3.0.02,6]undecane-10,1'-cyclopropane]-7-one.
What is the SMILES notation for (1S)-5-phenylspiro[4-oxa-6-azatricyclo[6.3.0.02,6]undecane-10,1'-cyclopropane]-7-one?
The canonical SMILES for (1S)-5-phenylspiro[4-oxa-6-azatricyclo[6.3.0.02,6]undecane-10,1'-cyclopropane]-7-one is O=C1C2CC3(CC3)C[C@@H]2C2COC(c3ccccc3)N12.
What is the InChIKey of (1S)-5-phenylspiro[4-oxa-6-azatricyclo[6.3.0.02,6]undecane-10,1'-cyclopropane]-7-one?
The InChIKey is JJUMUPUULUQELU-BAYAOMGESA-N. The full InChI is InChI=1S/C17H19NO2/c19-15-13-9-17(6-7-17)8-12(13)14-10-20-16(18(14)15)11-4-2-1-3-5-11/h1-5,12-14,16H,6-10H2/t12-,13?,14?,16?/m0/s1.
What are the key properties of (1S)-5-phenylspiro[4-oxa-6-azatricyclo[6.3.0.02,6]undecane-10,1'-cyclopropane]-7-one?
(1S)-5-phenylspiro[4-oxa-6-azatricyclo[6.3.0.02,6]undecane-10,1'-cyclopropane]-7-one has a molecular weight of 269.34 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-5-phenylspiro[4-oxa-6-azatricyclo[6.3.0.02,6]undecane-10,1'-cyclopropane]-7-one is sourced from PubChem (CID 58807843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).