About (3S)-6,10-dioxa-2-azaspiro[4.5]decane-2,3-dicarbaldehyde
(3S)-6,10-dioxa-2-azaspiro[4.5]decane-2,3-dicarbaldehyde (PubChem CID 58807855) has the molecular formula C9H13NO4
and a molecular weight of 199.21 g/mol. Its IUPAC name is (3S)-6,10-dioxa-2-azaspiro[4.5]decane-2,3-dicarbaldehyde.
Molecular Properties
| Compound Name | (3S)-6,10-dioxa-2-azaspiro[4.5]decane-2,3-dicarbaldehyde |
| PubChem CID | 58807855 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (3S)-6,10-dioxa-2-azaspiro[4.5]decane-2,3-dicarbaldehyde |
| SMILES | O=C[C@@H]1CC2(CN1C=O)OCCCO2 |
| InChI | InChI=1S/C9H13NO4/c11-5-8-4-9(6-10(8)7-12)13-2-1-3-14-9/h5,7-8H,1-4,6H2/t8-/m0/s1 |
| InChIKey | NWLDKYLRQZCYQX-QMMMGPOBSA-N |
| XLogP | -0.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3S)-6,10-dioxa-2-azaspiro[4.5]decane-2,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-6,10-dioxa-2-azaspiro[4.5]decane-2,3-dicarbaldehyde?
The IUPAC name of (3S)-6,10-dioxa-2-azaspiro[4.5]decane-2,3-dicarbaldehyde (CID 58807855) is (3S)-6,10-dioxa-2-azaspiro[4.5]decane-2,3-dicarbaldehyde.
What is the SMILES notation for (3S)-6,10-dioxa-2-azaspiro[4.5]decane-2,3-dicarbaldehyde?
The canonical SMILES for (3S)-6,10-dioxa-2-azaspiro[4.5]decane-2,3-dicarbaldehyde is O=C[C@@H]1CC2(CN1C=O)OCCCO2.
What is the InChIKey of (3S)-6,10-dioxa-2-azaspiro[4.5]decane-2,3-dicarbaldehyde?
The InChIKey is NWLDKYLRQZCYQX-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H13NO4/c11-5-8-4-9(6-10(8)7-12)13-2-1-3-14-9/h5,7-8H,1-4,6H2/t8-/m0/s1.
What are the key properties of (3S)-6,10-dioxa-2-azaspiro[4.5]decane-2,3-dicarbaldehyde?
(3S)-6,10-dioxa-2-azaspiro[4.5]decane-2,3-dicarbaldehyde has a molecular weight of 199.21 g/mol, XLogP of -0.45, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-6,10-dioxa-2-azaspiro[4.5]decane-2,3-dicarbaldehyde is sourced from PubChem (CID 58807855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).