About (1S)-10,10-difluoro-5-phenyl-4-oxa-6-azatricyclo[6.3.0.02,6]undecan-7-one
(1S)-10,10-difluoro-5-phenyl-4-oxa-6-azatricyclo[6.3.0.02,6]undecan-7-one (PubChem CID 58807898) has the molecular formula C15H15F2NO2
and a molecular weight of 279.29 g/mol. Its IUPAC name is (1S)-10,10-difluoro-5-phenyl-4-oxa-6-azatricyclo[6.3.0.02,6]undecan-7-one.
Molecular Properties
| Compound Name | (1S)-10,10-difluoro-5-phenyl-4-oxa-6-azatricyclo[6.3.0.02,6]undecan-7-one |
| PubChem CID | 58807898 |
| Molecular Formula | C15H15F2NO2 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | (1S)-10,10-difluoro-5-phenyl-4-oxa-6-azatricyclo[6.3.0.02,6]undecan-7-one |
| SMILES | O=C1C2CC(F)(F)C[C@@H]2C2COC(c3ccccc3)N12 |
| InChI | InChI=1S/C15H15F2NO2/c16-15(17)6-10-11(7-15)13(19)18-12(10)8-20-14(18)9-4-2-1-3-5-9/h1-5,10-12,14H,6-8H2/t10-,11?,12?,14?/m0/s1 |
| InChIKey | NHAWPOWXUOZIEW-ZZIMEFBRSA-N |
| XLogP | 2.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-10,10-difluoro-5-phenyl-4-oxa-6-azatricyclo[6.3.0.02,6]undecan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-10,10-difluoro-5-phenyl-4-oxa-6-azatricyclo[6.3.0.02,6]undecan-7-one?
The IUPAC name of (1S)-10,10-difluoro-5-phenyl-4-oxa-6-azatricyclo[6.3.0.02,6]undecan-7-one (CID 58807898) is (1S)-10,10-difluoro-5-phenyl-4-oxa-6-azatricyclo[6.3.0.02,6]undecan-7-one.
What is the SMILES notation for (1S)-10,10-difluoro-5-phenyl-4-oxa-6-azatricyclo[6.3.0.02,6]undecan-7-one?
The canonical SMILES for (1S)-10,10-difluoro-5-phenyl-4-oxa-6-azatricyclo[6.3.0.02,6]undecan-7-one is O=C1C2CC(F)(F)C[C@@H]2C2COC(c3ccccc3)N12.
What is the InChIKey of (1S)-10,10-difluoro-5-phenyl-4-oxa-6-azatricyclo[6.3.0.02,6]undecan-7-one?
The InChIKey is NHAWPOWXUOZIEW-ZZIMEFBRSA-N. The full InChI is InChI=1S/C15H15F2NO2/c16-15(17)6-10-11(7-15)13(19)18-12(10)8-20-14(18)9-4-2-1-3-5-9/h1-5,10-12,14H,6-8H2/t10-,11?,12?,14?/m0/s1.
What are the key properties of (1S)-10,10-difluoro-5-phenyl-4-oxa-6-azatricyclo[6.3.0.02,6]undecan-7-one?
(1S)-10,10-difluoro-5-phenyl-4-oxa-6-azatricyclo[6.3.0.02,6]undecan-7-one has a molecular weight of 279.29 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-10,10-difluoro-5-phenyl-4-oxa-6-azatricyclo[6.3.0.02,6]undecan-7-one is sourced from PubChem (CID 58807898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).